C16H27IO2Si — CID 11774126
(2E,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3-methylnona-2,6,8-trienal (PubChem CID 11774126) has the molecular formula C16H27IO2Si and a molecular weight of 406.38 g/mol. Its IUPAC name is (2E,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3-methylnona-2,6,8-trienal.
| Compound Name | (2E,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3-methylnona-2,6,8-trienal |
|---|---|
| PubChem CID | 11774126 |
| Molecular Formula | C16H27IO2Si |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | (2E,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3-methylnona-2,6,8-trienal |
| SMILES | C/C(=C\C=O)C[C@H](/C=C/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H27IO2Si/c1-14(10-12-18)13-15(9-7-8-11-17)19-20(5,6)16(2,3)4/h7-12,15H,13H2,1-6H3/b9-7+,11-8+,14-10+/t15-/m0/s1 |
| InChIKey | XJAJTAVBHQCPDR-RHPYSVNSSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|