C19H39IO3Si2 — CID 101448696
(E,2R,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enal (PubChem CID 101448696) has the molecular formula C19H39IO3Si2 and a molecular weight of 498.59 g/mol. Its IUPAC name is (E,2R,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enal.
| Compound Name | (E,2R,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enal |
|---|---|
| PubChem CID | 101448696 |
| Molecular Formula | C19H39IO3Si2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (E,2R,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C/C=C/I)C[C@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H39IO3Si2/c1-18(2,3)24(7,8)22-16(12-11-13-20)14-17(15-21)23-25(9,10)19(4,5)6/h11,13,15-17H,12,14H2,1-10H3/b13-11+/t16-,17-/m1/s1 |
| InChIKey | QBHIZSYKLORDKL-HZTRFMAJSA-N |
| XLogP | 6.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|