C13H24O2Si — CID 101352532
(2E)-5-[tert-butyl(dimethyl)silyl]oxyhepta-2,6-dienal (PubChem CID 101352532) has the molecular formula C13H24O2Si and a molecular weight of 240.42 g/mol. Its IUPAC name is (2E)-5-[tert-butyl(dimethyl)silyl]oxyhepta-2,6-dienal.
| Compound Name | (2E)-5-[tert-butyl(dimethyl)silyl]oxyhepta-2,6-dienal |
|---|---|
| PubChem CID | 101352532 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (2E)-5-[tert-butyl(dimethyl)silyl]oxyhepta-2,6-dienal |
| SMILES | C=CC(C/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H24O2Si/c1-7-12(10-8-9-11-14)15-16(5,6)13(2,3)4/h7-9,11-12H,1,10H2,2-6H3/b9-8+ |
| InChIKey | DKACCOSQIINKKU-CMDGGOBGSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|