C20H40O4SSi2 — CID 123987237
2-trimethylsilylethyl (3S)-7-acetylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoate (PubChem CID 123987237) has the molecular formula C20H40O4SSi2 and a molecular weight of 432.78 g/mol. Its IUPAC name is 2-trimethylsilylethyl (3S)-7-acetylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoate.
| Compound Name | 2-trimethylsilylethyl (3S)-7-acetylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoate |
|---|---|
| PubChem CID | 123987237 |
| Molecular Formula | C20H40O4SSi2 |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-trimethylsilylethyl (3S)-7-acetylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoate |
| SMILES | CC(=O)SCCC=C[C@H](CC(=O)OCC[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4SSi2/c1-17(21)25-14-11-10-12-18(24-27(8,9)20(2,3)4)16-19(22)23-13-15-26(5,6)7/h10,12,18H,11,13-16H2,1-9H3/t18-/m1/s1 |
| InChIKey | ATPMBHRZTRWHHT-GOSISDBHSA-N |
| XLogP | 5.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|