C34H45NO7SSi — CID 25105117
2-trimethylsilylethyl (E,3S)-7-acetylsulfanyl-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxyhept-4-enoate (PubChem CID 25105117) has the molecular formula C34H45NO7SSi and a molecular weight of 639.89 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E,3S)-7-acetylsulfanyl-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxyhept-4-enoate.
| Compound Name | 2-trimethylsilylethyl (E,3S)-7-acetylsulfanyl-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxyhept-4-enoate |
|---|---|
| PubChem CID | 25105117 |
| Molecular Formula | C34H45NO7SSi |
| Molecular Weight | 639.89 g/mol |
| Exact Mass | 639.27 |
| IUPAC Name | 2-trimethylsilylethyl (E,3S)-7-acetylsulfanyl-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxyhept-4-enoate |
| SMILES | CC(=O)SCC/C=C/[C@H](CC(=O)OCC[Si](C)(C)C)OC(=O)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C |
| InChI | InChI=1S/C34H45NO7SSi/c1-23(2)32(35-34(39)41-22-30-28-16-9-7-14-26(28)27-15-8-10-17-29(27)30)33(38)42-25(13-11-12-19-43-24(3)36)21-31(37)40-18-20-44(4,5)6/h7-11,13-17,23,25,30,32H,12,18-22H2,1-6H3,(H,35,39)/b13-11+/t25-,32+/m1/s1 |
| InChIKey | UZEDRLGHLLTISA-VBAKOUPKSA-N |
| XLogP | 6.96 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.89 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|