C29H40N2O6Si — CID 25150562
2-trimethylsilylethyl (2S)-2-[[(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoyl]amino]-3-methylbutanoate (PubChem CID 25150562) has the molecular formula C29H40N2O6Si and a molecular weight of 540.73 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S)-2-[[(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoyl]amino]-3-methylbutanoate.
| Compound Name | 2-trimethylsilylethyl (2S)-2-[[(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 25150562 |
| Molecular Formula | C29H40N2O6Si |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 2-trimethylsilylethyl (2S)-2-[[(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoyl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](C)O)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C29H40N2O6Si/c1-18(2)25(28(34)36-15-16-38(4,5)6)30-27(33)26(19(3)32)31-29(35)37-17-24-22-13-9-7-11-20(22)21-12-8-10-14-23(21)24/h7-14,18-19,24-26,32H,15-17H2,1-6H3,(H,30,33)(H,31,35)/t19-,25+,26+/m1/s1 |
| InChIKey | IKCOAVZSIPYWSB-PBXQCXKZSA-N |
| XLogP | 4.30 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|