C34H45NO8Si — CID 123328066
7-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxy-9-oxo-9-(2-trimethylsilylethoxy)non-4-enoic acid (PubChem CID 123328066) has the molecular formula C34H45NO8Si and a molecular weight of 623.82 g/mol. Its IUPAC name is 7-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxy-9-oxo-9-(2-trimethylsilylethoxy)non-4-enoic acid.
| Compound Name | 7-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxy-9-oxo-9-(2-trimethylsilylethoxy)non-4-enoic acid |
|---|---|
| PubChem CID | 123328066 |
| Molecular Formula | C34H45NO8Si |
| Molecular Weight | 623.82 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | 7-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxy-9-oxo-9-(2-trimethylsilylethoxy)non-4-enoic acid |
| SMILES | CC(C)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(CC=CCCC(=O)O)CC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C34H45NO8Si/c1-23(2)32(35-34(40)42-22-29-27-16-11-9-14-25(27)26-15-10-12-17-28(26)29)33(39)43-24(13-7-6-8-18-30(36)37)21-31(38)41-19-20-44(3,4)5/h6-7,9-12,14-17,23-24,29,32H,8,13,18-22H2,1-5H3,(H,35,40)(H,36,37)/t24?,32-/m0/s1 |
| InChIKey | WLLHXPDDDHHUKO-TWAVRPEISA-N |
| XLogP | 6.54 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.82 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|