C51H57NO6SSi — CID 25058652
2-trimethylsilylethyl (E,3S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxy-7-tritylsulfanylhept-4-enoate (PubChem CID 25058652) has the molecular formula C51H57NO6SSi and a molecular weight of 840.17 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E,3S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxy-7-tritylsulfanylhept-4-enoate.
| Compound Name | 2-trimethylsilylethyl (E,3S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxy-7-tritylsulfanylhept-4-enoate |
|---|---|
| PubChem CID | 25058652 |
| Molecular Formula | C51H57NO6SSi |
| Molecular Weight | 840.17 g/mol |
| Exact Mass | 839.37 |
| IUPAC Name | 2-trimethylsilylethyl (E,3S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxy-7-tritylsulfanylhept-4-enoate |
| SMILES | CC(C)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O[C@H](/C=C/CCSC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C51H57NO6SSi/c1-37(2)48(52-50(55)57-36-46-44-30-17-15-28-42(44)43-29-16-18-31-45(43)46)49(54)58-41(35-47(53)56-32-34-60(3,4)5)27-19-20-33-59-51(38-21-9-6-10-22-38,39-23-11-7-12-24-39)40-25-13-8-14-26-40/h6-19,21-31,37,41,46,48H,20,32-36H2,1-5H3,(H,52,55)/b27-19+/t41-,48+/m1/s1 |
| InChIKey | UMXIFYKQOQZRDK-KLVIBABGSA-N |
| XLogP | 11.40 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.17 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|