C29H33NO8 — CID 70236471
(Z)-7-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxynon-4-enedioic acid (PubChem CID 70236471) has the molecular formula C29H33NO8 and a molecular weight of 523.58 g/mol. Its IUPAC name is (Z)-7-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxynon-4-enedioic acid.
| Compound Name | (Z)-7-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxynon-4-enedioic acid |
|---|---|
| PubChem CID | 70236471 |
| Molecular Formula | C29H33NO8 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | (Z)-7-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxynon-4-enedioic acid |
| SMILES | CC(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(C/C=C\CCC(=O)O)CC(=O)O |
| InChI | InChI=1S/C29H33NO8/c1-18(2)27(28(35)38-19(16-26(33)34)10-4-3-5-15-25(31)32)30-29(36)37-17-24-22-13-8-6-11-20(22)21-12-7-9-14-23(21)24/h3-4,6-9,11-14,18-19,24,27H,5,10,15-17H2,1-2H3,(H,30,36)(H,31,32)(H,33,34)/b4-3- |
| InChIKey | LQCKKBHMEXESGJ-ARJAWSKDSA-N |
| XLogP | 4.75 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|