C19H18NO4Se — CID 101486184
CID 101486184 (PubChem CID 101486184) has the molecular formula C19H18NO4Se and a molecular weight of 403.32 g/mol.
| Compound Name | CID 101486184 |
|---|---|
| PubChem CID | 101486184 |
| Molecular Formula | C19H18NO4Se |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | — |
| SMILES | C[C@H](O)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)[Se] |
| InChI | InChI=1S/C19H18NO4Se/c1-11(21)17(18(22)25)20-19(23)24-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,11,16-17,21H,10H2,1H3,(H,20,23)/t11-,17+/m0/s1 |
| InChIKey | AYFFUBODRVSFDV-APPDUMDISA-N |
| XLogP | 1.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|