C22H44O4SSi2 — CID 90362165
2-trimethylsilylethyl (E,3S)-7-butanoylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoate (PubChem CID 90362165) has the molecular formula C22H44O4SSi2 and a molecular weight of 460.83 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E,3S)-7-butanoylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoate.
| Compound Name | 2-trimethylsilylethyl (E,3S)-7-butanoylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoate |
|---|---|
| PubChem CID | 90362165 |
| Molecular Formula | C22H44O4SSi2 |
| Molecular Weight | 460.83 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 2-trimethylsilylethyl (E,3S)-7-butanoylsulfanyl-3-[tert-butyl(dimethyl)silyl]oxyhept-4-enoate |
| SMILES | CCCC(=O)SCC/C=C/[C@H](CC(=O)OCC[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O4SSi2/c1-10-13-21(24)27-16-12-11-14-19(26-29(8,9)22(2,3)4)18-20(23)25-15-17-28(5,6)7/h11,14,19H,10,12-13,15-18H2,1-9H3/b14-11+/t19-/m1/s1 |
| InChIKey | KRBFEMKRNWMIDH-FIIODCPWSA-N |
| XLogP | 6.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.83 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|