C18H33ClO3Si — CID 132535606
[(2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-8-chloro-3,7-dimethylocta-2,6-dienyl] acetate (PubChem CID 132535606) has the molecular formula C18H33ClO3Si and a molecular weight of 361.00 g/mol. Its IUPAC name is [(2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-8-chloro-3,7-dimethylocta-2,6-dienyl] acetate.
| Compound Name | [(2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-8-chloro-3,7-dimethylocta-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 132535606 |
| Molecular Formula | C18H33ClO3Si |
| Molecular Weight | 361.00 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [(2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-8-chloro-3,7-dimethylocta-2,6-dienyl] acetate |
| SMILES | CC(=O)OC(/C=C(\C)CC/C=C(\C)CCl)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H33ClO3Si/c1-14(10-9-11-15(2)13-19)12-17(21-16(3)20)22-23(7,8)18(4,5)6/h11-12,17H,9-10,13H2,1-8H3/b14-12+,15-11+ |
| InChIKey | CTNYPFABXFLYCI-IEXJHRSDSA-N |
| XLogP | 5.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.00 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|