C16H33NO4Si — CID 58077726
(4R)-4-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,2-dimethyl-7-oxoheptanamide (PubChem CID 58077726) has the molecular formula C16H33NO4Si and a molecular weight of 331.53 g/mol. Its IUPAC name is (4R)-4-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,2-dimethyl-7-oxoheptanamide.
| Compound Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,2-dimethyl-7-oxoheptanamide |
|---|---|
| PubChem CID | 58077726 |
| Molecular Formula | C16H33NO4Si |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,2-dimethyl-7-oxoheptanamide |
| SMILES | CON(C)C(=O)C(C)C[C@@H](CCC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO4Si/c1-13(15(19)17(5)20-6)12-14(10-9-11-18)21-22(7,8)16(2,3)4/h11,13-14H,9-10,12H2,1-8H3/t13?,14-/m1/s1 |
| InChIKey | CGUDCUSTUMFEEQ-ARLHGKGLSA-N |
| XLogP | 3.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|