C17H36N2O3Si — CID 101449444
(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylamino)-N-methoxyoct-7-enamide (PubChem CID 101449444) has the molecular formula C17H36N2O3Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylamino)-N-methoxyoct-7-enamide.
| Compound Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylamino)-N-methoxyoct-7-enamide |
|---|---|
| PubChem CID | 101449444 |
| Molecular Formula | C17H36N2O3Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethylamino)-N-methoxyoct-7-enamide |
| SMILES | C=CCC[C@H](C[C@H](C(=O)NOC)N(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36N2O3Si/c1-10-11-12-14(22-23(8,9)17(2,3)4)13-15(19(5)6)16(20)18-21-7/h10,14-15H,1,11-13H2,2-9H3,(H,18,20)/t14-,15-/m1/s1 |
| InChIKey | QPCNMTQQHZUQFD-HUUCEWRRSA-N |
| XLogP | 3.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|