C24H47NO4Si — CID 66572021
(2S,3R,6S,8S,9R,10S)-3-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-N-methoxy-N,2,6,8,10-pentamethyldodec-11-ynamide (PubChem CID 66572021) has the molecular formula C24H47NO4Si and a molecular weight of 441.73 g/mol. Its IUPAC name is (2S,3R,6S,8S,9R,10S)-3-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-N-methoxy-N,2,6,8,10-pentamethyldodec-11-ynamide.
| Compound Name | (2S,3R,6S,8S,9R,10S)-3-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-N-methoxy-N,2,6,8,10-pentamethyldodec-11-ynamide |
|---|---|
| PubChem CID | 66572021 |
| Molecular Formula | C24H47NO4Si |
| Molecular Weight | 441.73 g/mol |
| Exact Mass | 441.33 |
| IUPAC Name | (2S,3R,6S,8S,9R,10S)-3-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-N-methoxy-N,2,6,8,10-pentamethyldodec-11-ynamide |
| SMILES | C#C[C@H](C)[C@H](O)[C@@H](C)C[C@@H](C)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C24H47NO4Si/c1-13-18(3)22(26)19(4)16-17(2)14-15-21(20(5)23(27)25(9)28-10)29-30(11,12)24(6,7)8/h1,17-22,26H,14-16H2,2-12H3/t17-,18-,19-,20-,21+,22-/m0/s1 |
| InChIKey | POUSUEYHLBDYIF-LLTZGFESSA-N |
| XLogP | 5.11 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.73 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|