C33H66O4Si2 — CID 11387676
(2R,3R,4S,6S,9R,10R,11S,12S,13Z)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxy-2,4,6,10,12-pentamethylhexadeca-13,15-dienal (PubChem CID 11387676) has the molecular formula C33H66O4Si2 and a molecular weight of 583.06 g/mol. Its IUPAC name is (2R,3R,4S,6S,9R,10R,11S,12S,13Z)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxy-2,4,6,10,12-pentamethylhexadeca-13,15-dienal.
| Compound Name | (2R,3R,4S,6S,9R,10R,11S,12S,13Z)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxy-2,4,6,10,12-pentamethylhexadeca-13,15-dienal |
|---|---|
| PubChem CID | 11387676 |
| Molecular Formula | C33H66O4Si2 |
| Molecular Weight | 583.06 g/mol |
| Exact Mass | 582.45 |
| IUPAC Name | (2R,3R,4S,6S,9R,10R,11S,12S,13Z)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxy-2,4,6,10,12-pentamethylhexadeca-13,15-dienal |
| SMILES | C=C/C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](CC[C@H](C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H66O4Si2/c1-17-18-19-25(3)30(35)28(6)29(36-38(13,14)32(7,8)9)21-20-24(2)22-26(4)31(27(5)23-34)37-39(15,16)33(10,11)12/h17-19,23-31,35H,1,20-22H2,2-16H3/b19-18-/t24-,25-,26-,27-,28-,29+,30-,31+/m0/s1 |
| InChIKey | IXWXFHPRQCSJMM-ANEIGNIMSA-N |
| XLogP | 9.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.06 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|