C33H67NO5Si2 — CID 58762113
(6S,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-N-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentyl]-5-hydroxy-N,2,4,6-tetramethyldeca-7,9-dienamide (PubChem CID 58762113) has the molecular formula C33H67NO5Si2 and a molecular weight of 614.07 g/mol. Its IUPAC name is (6S,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-N-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentyl]-5-hydroxy-N,2,4,6-tetramethyldeca-7,9-dienamide.
| Compound Name | (6S,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-N-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentyl]-5-hydroxy-N,2,4,6-tetramethyldeca-7,9-dienamide |
|---|---|
| PubChem CID | 58762113 |
| Molecular Formula | C33H67NO5Si2 |
| Molecular Weight | 614.07 g/mol |
| Exact Mass | 613.46 |
| IUPAC Name | (6S,7Z)-3-[tert-butyl(dimethyl)silyl]oxy-N-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentyl]-5-hydroxy-N,2,4,6-tetramethyldeca-7,9-dienamide |
| SMILES | C=C/C=C\[C@H](C)C(O)C(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(=O)N(C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C33H67NO5Si2/c1-18-19-20-23(2)28(36)26(5)30(39-41(16,17)33(10,11)12)27(6)31(37)34(13)21-24(3)29(25(4)22-35)38-40(14,15)32(7,8)9/h18-20,23-30,35-36H,1,21-22H2,2-17H3/b20-19-/t23-,24-,25-,26?,27?,28?,29+,30?/m0/s1 |
| InChIKey | DGRHBGRCJRRESR-ZRQWKXBPSA-N |
| XLogP | 7.50 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.07 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|