C17H38O4Si — CID 90954656
(3S,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctane-1,3,8-triol (PubChem CID 90954656) has the molecular formula C17H38O4Si and a molecular weight of 334.57 g/mol. Its IUPAC name is (3S,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctane-1,3,8-triol.
| Compound Name | (3S,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctane-1,3,8-triol |
|---|---|
| PubChem CID | 90954656 |
| Molecular Formula | C17H38O4Si |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (3S,4R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctane-1,3,8-triol |
| SMILES | CC(CO)[C@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCO |
| InChI | InChI=1S/C17H38O4Si/c1-12(9-10-18)16(14(3)15(20)13(2)11-19)21-22(7,8)17(4,5)6/h12-16,18-20H,9-11H2,1-8H3/t12-,13?,14+,15-,16+/m0/s1 |
| InChIKey | UJZDSRIGCRJIPF-KHEOEIQESA-N |
| XLogP | 3.02 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|