C16H34O3Si — CID 139994433
(2S,3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-6-ene-1,3-diol (PubChem CID 139994433) has the molecular formula C16H34O3Si and a molecular weight of 302.53 g/mol. Its IUPAC name is (2S,3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-6-ene-1,3-diol.
| Compound Name | (2S,3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-6-ene-1,3-diol |
|---|---|
| PubChem CID | 139994433 |
| Molecular Formula | C16H34O3Si |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | (2S,3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-6-ene-1,3-diol |
| SMILES | C=C(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C16H34O3Si/c1-11(2)15(13(4)14(18)12(3)10-17)19-20(8,9)16(5,6)7/h12-15,17-18H,1,10H2,2-9H3/t12-,13-,14-,15-/m0/s1 |
| InChIKey | ANQXJKBIJREJEX-AJNGGQMLSA-N |
| XLogP | 3.58 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|