C18H38O3Si — CID 91130793
(3S,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-7-ene-1,3-diol (PubChem CID 91130793) has the molecular formula C18H38O3Si and a molecular weight of 330.59 g/mol. Its IUPAC name is (3S,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-7-ene-1,3-diol.
| Compound Name | (3S,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-7-ene-1,3-diol |
|---|---|
| PubChem CID | 91130793 |
| Molecular Formula | C18H38O3Si |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (3S,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-7-ene-1,3-diol |
| SMILES | CC=C[C@](C)(C[C@@H](C)[C@H](O)C(C)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O3Si/c1-10-11-18(7,21-22(8,9)17(4,5)6)12-14(2)16(20)15(3)13-19/h10-11,14-16,19-20H,12-13H2,1-9H3/t14-,15?,16+,18-/m1/s1 |
| InChIKey | UQMZUHTVJDCQCS-OJISTFMOSA-N |
| XLogP | 4.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|