C21H44O7Si — CID 101022370
[(2R,3R,4S,5R,6R,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9-tetrahydroxy-2,4,6,8-tetramethylnonyl] acetate (PubChem CID 101022370) has the molecular formula C21H44O7Si and a molecular weight of 436.66 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9-tetrahydroxy-2,4,6,8-tetramethylnonyl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9-tetrahydroxy-2,4,6,8-tetramethylnonyl] acetate |
|---|---|
| PubChem CID | 101022370 |
| Molecular Formula | C21H44O7Si |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | [(2R,3R,4S,5R,6R,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9-tetrahydroxy-2,4,6,8-tetramethylnonyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)[C@@H](O)[C@H](C)[C@](O)(O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C21H44O7Si/c1-13(11-22)18(24)15(3)21(26,28-29(9,10)20(6,7)8)16(4)19(25)14(2)12-27-17(5)23/h13-16,18-19,22,24-26H,11-12H2,1-10H3/t13-,14+,15+,16-,18-,19+,21+/m0/s1 |
| InChIKey | ROFBLMLRBQCIAG-GHTOYWANSA-N |
| XLogP | 2.52 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|