C16H32O5Si — CID 10544588
[2-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-4,4-dimethyl-3-oxopentyl] acetate (PubChem CID 10544588) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-4,4-dimethyl-3-oxopentyl] acetate.
| Compound Name | [2-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-4,4-dimethyl-3-oxopentyl] acetate |
|---|---|
| PubChem CID | 10544588 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-4,4-dimethyl-3-oxopentyl] acetate |
| SMILES | CC(=O)OCC(CO)(O[Si](C)(C)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H32O5Si/c1-12(18)20-11-16(10-17,13(19)14(2,3)4)21-22(8,9)15(5,6)7/h17H,10-11H2,1-9H3 |
| InChIKey | MNAWTOFMZMWKLW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|