C24H55NO4Si3 — CID 91697077
N-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]propan-2-yl]acetamide (PubChem CID 91697077) has the molecular formula C24H55NO4Si3 and a molecular weight of 505.97 g/mol. Its IUPAC name is N-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]propan-2-yl]acetamide.
| Compound Name | N-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 91697077 |
| Molecular Formula | C24H55NO4Si3 |
| Molecular Weight | 505.97 g/mol |
| Exact Mass | 505.34 |
| IUPAC Name | N-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxymethyl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(CO[Si](C)(C)C(C)(C)C)(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H55NO4Si3/c1-20(26)25-24(17-27-30(11,12)21(2,3)4,18-28-31(13,14)22(5,6)7)19-29-32(15,16)23(8,9)10/h17-19H2,1-16H3,(H,25,26) |
| InChIKey | WCRJHAFPRYUYMJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.97 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|