C36H59NO4Si2 — CID 15516680
N-[1-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]acetamide (PubChem CID 15516680) has the molecular formula C36H59NO4Si2 and a molecular weight of 626.04 g/mol. Its IUPAC name is N-[1-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]acetamide.
| Compound Name | N-[1-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 15516680 |
| Molecular Formula | C36H59NO4Si2 |
| Molecular Weight | 626.04 g/mol |
| Exact Mass | 625.40 |
| IUPAC Name | N-[1-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]acetamide |
| SMILES | CC(=O)NC(CCc1ccc(C(=O)CCCCc2ccccc2)cc1)(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H59NO4Si2/c1-29(38)37-36(27-40-42(8,9)34(2,3)4,28-41-43(10,11)35(5,6)7)26-25-31-21-23-32(24-22-31)33(39)20-16-15-19-30-17-13-12-14-18-30/h12-14,17-18,21-24H,15-16,19-20,25-28H2,1-11H3,(H,37,38) |
| InChIKey | IDHMNXJURHZPSA-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.04 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|