C15H31NO4Si — CID 74079206
tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxopropan-2-yl]carbamate (PubChem CID 74079206) has the molecular formula C15H31NO4Si and a molecular weight of 317.50 g/mol. Its IUPAC name is tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 74079206 |
| Molecular Formula | C15H31NO4Si |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | tert-butyl N-[1-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxopropan-2-yl]carbamate |
| SMILES | CC(C=O)(CO[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H31NO4Si/c1-13(2,3)20-12(18)16-15(7,10-17)11-19-21(8,9)14(4,5)6/h10H,11H2,1-9H3,(H,16,18) |
| InChIKey | XKAURNAJCMIZPT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|