C12H23NO3 — CID 122599124
tert-butyl N-[(2S)-2-methyl-1-oxohexan-2-yl]carbamate (PubChem CID 122599124) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-methyl-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-methyl-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 122599124 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | tert-butyl N-[(2S)-2-methyl-1-oxohexan-2-yl]carbamate |
| SMILES | CCCC[C@@](C)(C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO3/c1-6-7-8-12(5,9-14)13-10(15)16-11(2,3)4/h9H,6-8H2,1-5H3,(H,13,15)/t12-/m0/s1 |
| InChIKey | JNJNRNDKPHRSLP-LBPRGKRZSA-N |
| XLogP | 2.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|