C16H34N2O2 — CID 107250019
tert-butyl N-[1-(heptylamino)-2-methylpropan-2-yl]carbamate (PubChem CID 107250019) has the molecular formula C16H34N2O2 and a molecular weight of 286.46 g/mol. Its IUPAC name is tert-butyl N-[1-(heptylamino)-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(heptylamino)-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 107250019 |
| Molecular Formula | C16H34N2O2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | tert-butyl N-[1-(heptylamino)-2-methylpropan-2-yl]carbamate |
| SMILES | CCCCCCCNCC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H34N2O2/c1-7-8-9-10-11-12-17-13-16(5,6)18-14(19)20-15(2,3)4/h17H,7-13H2,1-6H3,(H,18,19) |
| InChIKey | XFJDQGKLRURVCK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|