About tert-butyl 2-(octylamino)acetate
tert-butyl 2-(octylamino)acetate (PubChem CID 78913453) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is tert-butyl 2-(octylamino)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(octylamino)acetate |
| PubChem CID | 78913453 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | tert-butyl 2-(octylamino)acetate |
| SMILES | CCCCCCCCNCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H29NO2/c1-5-6-7-8-9-10-11-15-12-13(16)17-14(2,3)4/h15H,5-12H2,1-4H3 |
| InChIKey | YHWVUIOJVAYLSG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(octylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(octylamino)acetate?
The IUPAC name of tert-butyl 2-(octylamino)acetate (CID 78913453) is tert-butyl 2-(octylamino)acetate.
What is the SMILES notation for tert-butyl 2-(octylamino)acetate?
The canonical SMILES for tert-butyl 2-(octylamino)acetate is CCCCCCCCNCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-(octylamino)acetate?
The InChIKey is YHWVUIOJVAYLSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2/c1-5-6-7-8-9-10-11-15-12-13(16)17-14(2,3)4/h15H,5-12H2,1-4H3.
What are the key properties of tert-butyl 2-(octylamino)acetate?
tert-butyl 2-(octylamino)acetate has a molecular weight of 243.39 g/mol, XLogP of 3.28, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(octylamino)acetate is sourced from PubChem (CID 78913453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).