About butyl 2-(octylamino)acetate
butyl 2-(octylamino)acetate (PubChem CID 115567498) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is butyl 2-(octylamino)acetate.
Molecular Properties
| Compound Name | butyl 2-(octylamino)acetate |
| PubChem CID | 115567498 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | butyl 2-(octylamino)acetate |
| SMILES | CCCCCCCCNCC(=O)OCCCC |
| InChI | InChI=1S/C14H29NO2/c1-3-5-7-8-9-10-11-15-13-14(16)17-12-6-4-2/h15H,3-13H2,1-2H3 |
| InChIKey | ADSHRUDJHURZIC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-(octylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-(octylamino)acetate?
The IUPAC name of butyl 2-(octylamino)acetate (CID 115567498) is butyl 2-(octylamino)acetate.
What is the SMILES notation for butyl 2-(octylamino)acetate?
The canonical SMILES for butyl 2-(octylamino)acetate is CCCCCCCCNCC(=O)OCCCC.
What is the InChIKey of butyl 2-(octylamino)acetate?
The InChIKey is ADSHRUDJHURZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2/c1-3-5-7-8-9-10-11-15-13-14(16)17-12-6-4-2/h15H,3-13H2,1-2H3.
What are the key properties of butyl 2-(octylamino)acetate?
butyl 2-(octylamino)acetate has a molecular weight of 243.39 g/mol, XLogP of 3.28, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-(octylamino)acetate is sourced from PubChem (CID 115567498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).