About 2-(hexadecylamino)ethyl propanoate
2-(hexadecylamino)ethyl propanoate (PubChem CID 174467730) has the molecular formula C21H43NO2
and a molecular weight of 341.58 g/mol. Its IUPAC name is 2-(hexadecylamino)ethyl propanoate.
Molecular Properties
| Compound Name | 2-(hexadecylamino)ethyl propanoate |
| PubChem CID | 174467730 |
| Molecular Formula | C21H43NO2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.33 |
| IUPAC Name | 2-(hexadecylamino)ethyl propanoate |
| SMILES | CCCCCCCCCCCCCCCCNCCOC(=O)CC |
| InChI | InChI=1S/C21H43NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19-20-24-21(23)4-2/h22H,3-20H2,1-2H3 |
| InChIKey | NRTAJQNHNGBCEJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(hexadecylamino)ethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hexadecylamino)ethyl propanoate?
The IUPAC name of 2-(hexadecylamino)ethyl propanoate (CID 174467730) is 2-(hexadecylamino)ethyl propanoate.
What is the SMILES notation for 2-(hexadecylamino)ethyl propanoate?
The canonical SMILES for 2-(hexadecylamino)ethyl propanoate is CCCCCCCCCCCCCCCCNCCOC(=O)CC.
What is the InChIKey of 2-(hexadecylamino)ethyl propanoate?
The InChIKey is NRTAJQNHNGBCEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19-20-24-21(23)4-2/h22H,3-20H2,1-2H3.
What are the key properties of 2-(hexadecylamino)ethyl propanoate?
2-(hexadecylamino)ethyl propanoate has a molecular weight of 341.58 g/mol, XLogP of 6.01, 19 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hexadecylamino)ethyl propanoate is sourced from PubChem (CID 174467730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).