About tert-butyl N-(octylamino)carbamate
tert-butyl N-(octylamino)carbamate (PubChem CID 107237086) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is tert-butyl N-(octylamino)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(octylamino)carbamate |
| PubChem CID | 107237086 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | tert-butyl N-(octylamino)carbamate |
| SMILES | CCCCCCCCNNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-5-6-7-8-9-10-11-14-15-12(16)17-13(2,3)4/h14H,5-11H2,1-4H3,(H,15,16) |
| InChIKey | NYKTWWZNRBDZMC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(octylamino)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(octylamino)carbamate?
The IUPAC name of tert-butyl N-(octylamino)carbamate (CID 107237086) is tert-butyl N-(octylamino)carbamate.
What is the SMILES notation for tert-butyl N-(octylamino)carbamate?
The canonical SMILES for tert-butyl N-(octylamino)carbamate is CCCCCCCCNNC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(octylamino)carbamate?
The InChIKey is NYKTWWZNRBDZMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2/c1-5-6-7-8-9-10-11-14-15-12(16)17-13(2,3)4/h14H,5-11H2,1-4H3,(H,15,16).
What are the key properties of tert-butyl N-(octylamino)carbamate?
tert-butyl N-(octylamino)carbamate has a molecular weight of 244.38 g/mol, XLogP of 3.38, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(octylamino)carbamate is sourced from PubChem (CID 107237086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).