About methyl N-(hexylamino)carbamate
methyl N-(hexylamino)carbamate (PubChem CID 141204686) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is methyl N-(hexylamino)carbamate.
Molecular Properties
| Compound Name | methyl N-(hexylamino)carbamate |
| PubChem CID | 141204686 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | methyl N-(hexylamino)carbamate |
| SMILES | CCCCCCNNC(=O)OC |
| InChI | InChI=1S/C8H18N2O2/c1-3-4-5-6-7-9-10-8(11)12-2/h9H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | ZSDZKYDLPAVXCC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(hexylamino)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(hexylamino)carbamate?
The IUPAC name of methyl N-(hexylamino)carbamate (CID 141204686) is methyl N-(hexylamino)carbamate.
What is the SMILES notation for methyl N-(hexylamino)carbamate?
The canonical SMILES for methyl N-(hexylamino)carbamate is CCCCCCNNC(=O)OC.
What is the InChIKey of methyl N-(hexylamino)carbamate?
The InChIKey is ZSDZKYDLPAVXCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-3-4-5-6-7-9-10-8(11)12-2/h9H,3-7H2,1-2H3,(H,10,11).
What are the key properties of methyl N-(hexylamino)carbamate?
methyl N-(hexylamino)carbamate has a molecular weight of 174.24 g/mol, XLogP of 1.43, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(hexylamino)carbamate is sourced from PubChem (CID 141204686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).