About N-methyldecan-1-amine;methyl N-decylcarbamate
N-methyldecan-1-amine;methyl N-decylcarbamate (PubChem CID 137370679) has the molecular formula C23H50N2O2
and a molecular weight of 386.67 g/mol. Its IUPAC name is N-methyldecan-1-amine;methyl N-decylcarbamate.
Molecular Properties
| Compound Name | N-methyldecan-1-amine;methyl N-decylcarbamate |
| PubChem CID | 137370679 |
| Molecular Formula | C23H50N2O2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.39 |
| IUPAC Name | N-methyldecan-1-amine;methyl N-decylcarbamate |
| SMILES | CCCCCCCCCCNC.CCCCCCCCCCNC(=O)OC |
| InChI | InChI=1S/C12H25NO2.C11H25N/c1-3-4-5-6-7-8-9-10-11-13-12(14)15-2;1-3-4-5-6-7-8-9-10-11-12-2/h3-11H2,1-2H3,(H,13,14);12H,3-11H2,1-2H3 |
| InChIKey | JQHYYFGQOCXOMD-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyldecan-1-amine;methyl N-decylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyldecan-1-amine;methyl N-decylcarbamate?
The IUPAC name of N-methyldecan-1-amine;methyl N-decylcarbamate (CID 137370679) is N-methyldecan-1-amine;methyl N-decylcarbamate.
What is the SMILES notation for N-methyldecan-1-amine;methyl N-decylcarbamate?
The canonical SMILES for N-methyldecan-1-amine;methyl N-decylcarbamate is CCCCCCCCCCNC.CCCCCCCCCCNC(=O)OC.
What is the InChIKey of N-methyldecan-1-amine;methyl N-decylcarbamate?
The InChIKey is JQHYYFGQOCXOMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2.C11H25N/c1-3-4-5-6-7-8-9-10-11-13-12(14)15-2;1-3-4-5-6-7-8-9-10-11-12-2/h3-11H2,1-2H3,(H,13,14);12H,3-11H2,1-2H3.
What are the key properties of N-methyldecan-1-amine;methyl N-decylcarbamate?
N-methyldecan-1-amine;methyl N-decylcarbamate has a molecular weight of 386.67 g/mol, XLogP of 6.83, 18 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyldecan-1-amine;methyl N-decylcarbamate is sourced from PubChem (CID 137370679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).