C15H32N2O2 — CID 103788233
tert-butyl N-[1-(hexan-2-ylamino)-2-methylpropan-2-yl]carbamate (PubChem CID 103788233) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is tert-butyl N-[1-(hexan-2-ylamino)-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(hexan-2-ylamino)-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 103788233 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | tert-butyl N-[1-(hexan-2-ylamino)-2-methylpropan-2-yl]carbamate |
| SMILES | CCCCC(C)NCC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H32N2O2/c1-8-9-10-12(2)16-11-15(6,7)17-13(18)19-14(3,4)5/h12,16H,8-11H2,1-7H3,(H,17,18) |
| InChIKey | IDLOOLOLMJTFLP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |