C10H17NO4 — CID 59460326
tert-butyl N-(2-methyl-1,3-dioxobutan-2-yl)carbamate (PubChem CID 59460326) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is tert-butyl N-(2-methyl-1,3-dioxobutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(2-methyl-1,3-dioxobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 59460326 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | tert-butyl N-(2-methyl-1,3-dioxobutan-2-yl)carbamate |
| SMILES | CC(=O)C(C)(C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17NO4/c1-7(13)10(5,6-12)11-8(14)15-9(2,3)4/h6H,1-5H3,(H,11,14) |
| InChIKey | RUILJDQVEGDSEC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|