C13H20N2O3 — CID 59898094
tert-butyl N-[(Z,3S)-6-isocyano-3-methyl-2-oxohex-4-en-3-yl]carbamate (PubChem CID 59898094) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is tert-butyl N-[(Z,3S)-6-isocyano-3-methyl-2-oxohex-4-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(Z,3S)-6-isocyano-3-methyl-2-oxohex-4-en-3-yl]carbamate |
|---|---|
| PubChem CID | 59898094 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | tert-butyl N-[(Z,3S)-6-isocyano-3-methyl-2-oxohex-4-en-3-yl]carbamate |
| SMILES | [C-]#[N+]C/C=C\[C@](C)(NC(=O)OC(C)(C)C)C(C)=O |
| InChI | InChI=1S/C13H20N2O3/c1-10(16)13(5,8-7-9-14-6)15-11(17)18-12(2,3)4/h7-8H,9H2,1-5H3,(H,15,17)/b8-7-/t13-/m0/s1 |
| InChIKey | GHPWPCMCAKEIRQ-WSROAFLRSA-N |
| XLogP | 2.33 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|