C12H18N2O4 — CID 173227029
(2S)-5-cyano-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-3-enoic acid (PubChem CID 173227029) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2S)-5-cyano-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-3-enoic acid.
| Compound Name | (2S)-5-cyano-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-3-enoic acid |
|---|---|
| PubChem CID | 173227029 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2S)-5-cyano-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-3-enoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@](C)(C=CCC#N)C(=O)O |
| InChI | InChI=1S/C12H18N2O4/c1-11(2,3)18-10(17)14-12(4,9(15)16)7-5-6-8-13/h5,7H,6H2,1-4H3,(H,14,17)(H,15,16)/t12-/m0/s1 |
| InChIKey | LAXVTBWGJMIOAY-LBPRGKRZSA-N |
| XLogP | 1.82 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|