C13H24N2O4 — CID 90052280
tert-butyl N-(3-cyano-1,5-dimethoxypentan-3-yl)carbamate (PubChem CID 90052280) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is tert-butyl N-(3-cyano-1,5-dimethoxypentan-3-yl)carbamate.
| Compound Name | tert-butyl N-(3-cyano-1,5-dimethoxypentan-3-yl)carbamate |
|---|---|
| PubChem CID | 90052280 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | tert-butyl N-(3-cyano-1,5-dimethoxypentan-3-yl)carbamate |
| SMILES | COCCC(C#N)(CCOC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O4/c1-12(2,3)19-11(16)15-13(10-14,6-8-17-4)7-9-18-5/h6-9H2,1-5H3,(H,15,16) |
| InChIKey | LZMYADSVEWYWQE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |