C14H25N3O2 — CID 130466053
tert-butyl N-[(Z)-4-cyano-5-(dimethylamino)-2-methylpent-4-en-2-yl]carbamate (PubChem CID 130466053) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl N-[(Z)-4-cyano-5-(dimethylamino)-2-methylpent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(Z)-4-cyano-5-(dimethylamino)-2-methylpent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 130466053 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | tert-butyl N-[(Z)-4-cyano-5-(dimethylamino)-2-methylpent-4-en-2-yl]carbamate |
| SMILES | CN(C)/C=C(\C#N)CC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25N3O2/c1-13(2,3)19-12(18)16-14(4,5)8-11(9-15)10-17(6)7/h10H,8H2,1-7H3,(H,16,18)/b11-10- |
| InChIKey | FLPFIUYQPNGTGE-KHPPLWFESA-N |
| XLogP | 2.65 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|