C13H20N2O2 — CID 170299111
tert-butyl N-[(2E,4E)-4-cyano-2-methylhexa-2,4-dienyl]carbamate (PubChem CID 170299111) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is tert-butyl N-[(2E,4E)-4-cyano-2-methylhexa-2,4-dienyl]carbamate.
| Compound Name | tert-butyl N-[(2E,4E)-4-cyano-2-methylhexa-2,4-dienyl]carbamate |
|---|---|
| PubChem CID | 170299111 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | tert-butyl N-[(2E,4E)-4-cyano-2-methylhexa-2,4-dienyl]carbamate |
| SMILES | C/C=C(C#N)\C=C(/C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20N2O2/c1-6-11(8-14)7-10(2)9-15-12(16)17-13(3,4)5/h6-7H,9H2,1-5H3,(H,15,16)/b10-7+,11-6+ |
| InChIKey | MXBFWPUGZIICOK-NXAIOARDSA-N |
| XLogP | 2.93 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|