C28H31NO2S — CID 139702121
tert-butyl N-[(Z)-2-methyl-3-tritylsulfanylprop-2-enyl]carbamate (PubChem CID 139702121) has the molecular formula C28H31NO2S and a molecular weight of 445.63 g/mol. Its IUPAC name is tert-butyl N-[(Z)-2-methyl-3-tritylsulfanylprop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-2-methyl-3-tritylsulfanylprop-2-enyl]carbamate |
|---|---|
| PubChem CID | 139702121 |
| Molecular Formula | C28H31NO2S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | tert-butyl N-[(Z)-2-methyl-3-tritylsulfanylprop-2-enyl]carbamate |
| SMILES | C/C(=C/SC(c1ccccc1)(c1ccccc1)c1ccccc1)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H31NO2S/c1-22(20-29-26(30)31-27(2,3)4)21-32-28(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,21H,20H2,1-4H3,(H,29,30)/b22-21- |
| InChIKey | WPBHDSCFMVSPQG-DQRAZIAOSA-N |
| XLogP | 7.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|