C27H29NO3S — CID 67752238
tert-butyl N-(3-tritylsulfanylpropanoyl)carbamate (PubChem CID 67752238) has the molecular formula C27H29NO3S and a molecular weight of 447.60 g/mol. Its IUPAC name is tert-butyl N-(3-tritylsulfanylpropanoyl)carbamate.
| Compound Name | tert-butyl N-(3-tritylsulfanylpropanoyl)carbamate |
|---|---|
| PubChem CID | 67752238 |
| Molecular Formula | C27H29NO3S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | tert-butyl N-(3-tritylsulfanylpropanoyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=O)CCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO3S/c1-26(2,3)31-25(30)28-24(29)19-20-32-27(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18H,19-20H2,1-3H3,(H,28,29,30) |
| InChIKey | GPTGOZHJRKGGME-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|