C29H35N3O3S — CID 66858791
tert-butyl N-[(2R)-2-(1-aminoethylamino)-3-tritylsulfanylpropanoyl]carbamate (PubChem CID 66858791) has the molecular formula C29H35N3O3S and a molecular weight of 505.68 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-(1-aminoethylamino)-3-tritylsulfanylpropanoyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-(1-aminoethylamino)-3-tritylsulfanylpropanoyl]carbamate |
|---|---|
| PubChem CID | 66858791 |
| Molecular Formula | C29H35N3O3S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | tert-butyl N-[(2R)-2-(1-aminoethylamino)-3-tritylsulfanylpropanoyl]carbamate |
| SMILES | CC(N)N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H35N3O3S/c1-21(30)31-25(26(33)32-27(34)35-28(2,3)4)20-36-29(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19,21,25,31H,20,30H2,1-4H3,(H,32,33,34)/t21?,25-/m0/s1 |
| InChIKey | OCPLNWQCNVGQAL-QBGQUKIHSA-N |
| XLogP | 5.03 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|