C32H41IN2O4S — CID 67442286
trimethyl-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]oxyethyl]azanium iodide (PubChem CID 67442286) has the molecular formula C32H41IN2O4S and a molecular weight of 676.66 g/mol. Its IUPAC name is trimethyl-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]oxyethyl]azanium iodide.
| Compound Name | trimethyl-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]oxyethyl]azanium iodide |
|---|---|
| PubChem CID | 67442286 |
| Molecular Formula | C32H41IN2O4S |
| Molecular Weight | 676.66 g/mol |
| Exact Mass | 676.18 |
| IUPAC Name | trimethyl-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]oxyethyl]azanium iodide |
| SMILES | CC(C)(C)OC(=O)NC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC[N+](C)(C)C.[I-] |
| InChI | InChI=1S/C32H40N2O4S.HI/c1-31(2,3)38-30(36)33-28(29(35)37-23-22-34(4,5)6)24-39-32(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27;/h7-21,28H,22-24H2,1-6H3;1H |
| InChIKey | ZMMDECVNBRPVTJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.66 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|