C40H53N3O9S — CID 170393541
5-[2-[2-[2-[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]ethoxy]ethoxy]ethoxy]ethylamino]-5-oxopentanoic acid (PubChem CID 170393541) has the molecular formula C40H53N3O9S and a molecular weight of 751.94 g/mol. Its IUPAC name is 5-[2-[2-[2-[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]ethoxy]ethoxy]ethoxy]ethylamino]-5-oxopentanoic acid.
| Compound Name | 5-[2-[2-[2-[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]ethoxy]ethoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 170393541 |
| Molecular Formula | C40H53N3O9S |
| Molecular Weight | 751.94 g/mol |
| Exact Mass | 751.35 |
| IUPAC Name | 5-[2-[2-[2-[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoyl]amino]ethoxy]ethoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NCCOCCOCCOCCNC(=O)CCCC(=O)O |
| InChI | InChI=1S/C40H53N3O9S/c1-39(2,3)52-38(48)43-34(37(47)42-23-25-50-27-29-51-28-26-49-24-22-41-35(44)20-13-21-36(45)46)30-53-40(31-14-7-4-8-15-31,32-16-9-5-10-17-32)33-18-11-6-12-19-33/h4-12,14-19,34H,13,20-30H2,1-3H3,(H,41,44)(H,42,47)(H,43,48)(H,45,46)/t34-/m0/s1 |
| InChIKey | YHKCJUASGBMADU-UMSFTDKQSA-N |
| XLogP | 5.14 |
| TPSA | 161.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.94 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|