C30H34O3S — CID 154375895
tert-butyl (3S)-3-hydroxy-7-tritylsulfanylhept-4-enoate (PubChem CID 154375895) has the molecular formula C30H34O3S and a molecular weight of 474.67 g/mol. Its IUPAC name is tert-butyl (3S)-3-hydroxy-7-tritylsulfanylhept-4-enoate.
| Compound Name | tert-butyl (3S)-3-hydroxy-7-tritylsulfanylhept-4-enoate |
|---|---|
| PubChem CID | 154375895 |
| Molecular Formula | C30H34O3S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | tert-butyl (3S)-3-hydroxy-7-tritylsulfanylhept-4-enoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](O)C=CCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H34O3S/c1-29(2,3)33-28(32)23-27(31)21-13-14-22-34-30(24-15-7-4-8-16-24,25-17-9-5-10-18-25)26-19-11-6-12-20-26/h4-13,15-21,27,31H,14,22-23H2,1-3H3/t27-/m1/s1 |
| InChIKey | HYIJCKOCPWNYAF-HHHXNRCGSA-N |
| XLogP | 6.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|