C33H39NO5S — CID 158821781
7-O-tert-butyl 1-O-ethyl (2R,5S)-5-amino-4-oxo-2-(tritylsulfanylmethyl)heptanedioate (PubChem CID 158821781) has the molecular formula C33H39NO5S and a molecular weight of 561.74 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-ethyl (2R,5S)-5-amino-4-oxo-2-(tritylsulfanylmethyl)heptanedioate.
| Compound Name | 7-O-tert-butyl 1-O-ethyl (2R,5S)-5-amino-4-oxo-2-(tritylsulfanylmethyl)heptanedioate |
|---|---|
| PubChem CID | 158821781 |
| Molecular Formula | C33H39NO5S |
| Molecular Weight | 561.74 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 7-O-tert-butyl 1-O-ethyl (2R,5S)-5-amino-4-oxo-2-(tritylsulfanylmethyl)heptanedioate |
| SMILES | CCOC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)[C@@H](N)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H39NO5S/c1-5-38-31(37)24(21-29(35)28(34)22-30(36)39-32(2,3)4)23-40-33(25-15-9-6-10-16-25,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h6-20,24,28H,5,21-23,34H2,1-4H3/t24-,28-/m0/s1 |
| InChIKey | KFUBBFFJQIBAAI-CUBQBAPOSA-N |
| XLogP | 5.91 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.74 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|