C57H65N3O4S2 — CID 167626826
tert-butyl N-[2-[[(2R,5R)-5-(butylamino)-4-oxo-6-tritylsulfanyl-2-(tritylsulfanylmethyl)hexanoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 167626826) has the molecular formula C57H65N3O4S2 and a molecular weight of 920.30 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2R,5R)-5-(butylamino)-4-oxo-6-tritylsulfanyl-2-(tritylsulfanylmethyl)hexanoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[(2R,5R)-5-(butylamino)-4-oxo-6-tritylsulfanyl-2-(tritylsulfanylmethyl)hexanoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 167626826 |
| Molecular Formula | C57H65N3O4S2 |
| Molecular Weight | 920.30 g/mol |
| Exact Mass | 919.44 |
| IUPAC Name | tert-butyl N-[2-[[(2R,5R)-5-(butylamino)-4-oxo-6-tritylsulfanyl-2-(tritylsulfanylmethyl)hexanoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CCCCN[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)C[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C57H65N3O4S2/c1-6-7-38-58-51(43-66-57(48-32-20-11-21-33-48,49-34-22-12-23-35-49)50-36-24-13-25-37-50)52(61)41-44(53(62)59-39-40-60(5)54(63)64-55(2,3)4)42-65-56(45-26-14-8-15-27-45,46-28-16-9-17-29-46)47-30-18-10-19-31-47/h8-37,44,51,58H,6-7,38-43H2,1-5H3,(H,59,62)/t44-,51-/m0/s1 |
| InChIKey | DSUZAIHMWMSWQK-JZXIEBOPSA-N |
| XLogP | 11.75 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.30 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|