C41H52N2O8S — CID 58468545
4-O-tert-butyl 1-O-methyl (2S)-2-[[(2R,5S)-5-amino-8-[(2-methylpropan-2-yl)oxy]-4,8-dioxo-2-(tritylsulfanylmethyl)octanoyl]amino]butanedioate (PubChem CID 58468545) has the molecular formula C41H52N2O8S and a molecular weight of 732.94 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl (2S)-2-[[(2R,5S)-5-amino-8-[(2-methylpropan-2-yl)oxy]-4,8-dioxo-2-(tritylsulfanylmethyl)octanoyl]amino]butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl (2S)-2-[[(2R,5S)-5-amino-8-[(2-methylpropan-2-yl)oxy]-4,8-dioxo-2-(tritylsulfanylmethyl)octanoyl]amino]butanedioate |
|---|---|
| PubChem CID | 58468545 |
| Molecular Formula | C41H52N2O8S |
| Molecular Weight | 732.94 g/mol |
| Exact Mass | 732.34 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl (2S)-2-[[(2R,5S)-5-amino-8-[(2-methylpropan-2-yl)oxy]-4,8-dioxo-2-(tritylsulfanylmethyl)octanoyl]amino]butanedioate |
| SMILES | COC(=O)[C@H](CC(=O)OC(C)(C)C)NC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)[C@@H](N)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H52N2O8S/c1-39(2,3)50-35(45)24-23-32(42)34(44)25-28(37(47)43-33(38(48)49-7)26-36(46)51-40(4,5)6)27-52-41(29-17-11-8-12-18-29,30-19-13-9-14-20-30)31-21-15-10-16-22-31/h8-22,28,32-33H,23-27,42H2,1-7H3,(H,43,47)/t28-,32-,33-/m0/s1 |
| InChIKey | OMJJCAXDAHPQHI-RMFXYIPJSA-N |
| XLogP | 6.13 |
| TPSA | 151.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.94 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|