C37H46N2O6S — CID 68849856
(3S,4R)-3-hydroxy-4-[4-[[(3S)-3-hydroxy-7-tritylsulfanylhept-4-enoyl]amino]butanoylamino]-5-methylhexanoic acid (PubChem CID 68849856) has the molecular formula C37H46N2O6S and a molecular weight of 646.85 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-4-[4-[[(3S)-3-hydroxy-7-tritylsulfanylhept-4-enoyl]amino]butanoylamino]-5-methylhexanoic acid.
| Compound Name | (3S,4R)-3-hydroxy-4-[4-[[(3S)-3-hydroxy-7-tritylsulfanylhept-4-enoyl]amino]butanoylamino]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 68849856 |
| Molecular Formula | C37H46N2O6S |
| Molecular Weight | 646.85 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | (3S,4R)-3-hydroxy-4-[4-[[(3S)-3-hydroxy-7-tritylsulfanylhept-4-enoyl]amino]butanoylamino]-5-methylhexanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)CCCNC(=O)C[C@H](O)C=CCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C37H46N2O6S/c1-27(2)36(32(41)26-35(44)45)39-33(42)22-14-23-38-34(43)25-31(40)21-12-13-24-46-37(28-15-6-3-7-16-28,29-17-8-4-9-18-29)30-19-10-5-11-20-30/h3-12,15-21,27,31-32,36,40-41H,13-14,22-26H2,1-2H3,(H,38,43)(H,39,42)(H,44,45)/t31-,32+,36-/m1/s1 |
| InChIKey | IBLWKTTXEMALJX-FFTPJAJHSA-N |
| XLogP | 5.28 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.85 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|